CAS 61337-88-0
:3-Pyridinecarbonitrile,2-(4-methyl-2-phenyl-1-piperazinyl)-
Description:
3-Pyridinecarbonitrile, 2-(4-methyl-2-phenyl-1-piperazinyl)-, is a chemical compound characterized by its pyridine and piperazine moieties, which contribute to its biological activity and potential pharmacological applications. The structure features a pyridine ring with a cyano group (nitrile) at the 3-position and a piperazine ring substituted with a phenyl group and a methyl group at the 4-position. This compound is typically a solid at room temperature and exhibits properties such as solubility in polar organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both the piperazine and pyridine rings may enhance its ability to cross biological membranes and interact with various receptors. Additionally, the compound's unique functional groups may influence its reactivity and stability, making it a subject of study in various chemical and biological contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C17H18N4
InChI:InChI=1S/C17H18N4/c1-20-10-11-21(17-15(12-18)8-5-9-19-17)16(13-20)14-6-3-2-4-7-14/h2-9,16H,10-11,13H2,1H3
InChI key:DHUHYBBSQWQGSN-UHFFFAOYSA-N
SMILES:CN1CCN(C(C1)C2=CC=CC=C2)C3=C(C=CC=N3)C#N
Synonyms:- 1-(3-Cyano-2-pyridyl)-4-methyl-2-phenylpiperazine
- 2-(4-Methyl-2-phenylpiperazin-1-yl)-3-cyanopyridine
- 2-(4-Methyl-2-phenylpiperazin-1-yl)pyridine-3-carbonitrile
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(4-Methyl-2-phenylpiperazin-1-yl)nicotinonitrile
CAS:Formula:C17H18N4Color and Shape:SolidMolecular weight:278.35161-(3-Cyano-2-pyridyl)-4-methyl-2-phenylpiperazine
CAS:Applications Used in the preparation of Mirtazapine (M365000) impurities.
Formula:C17H18N4Color and Shape:NeatMolecular weight:278.351-(3-Cyano-2-pyridyl)-4-methyl-2-phenylpiperazine-d4
CAS:Controlled ProductFormula:C17D4H14N4Color and Shape:NeatMolecular weight:282.376



