CAS 61337-89-1
:1-(3-Hydroxymethyl-2-pyridyl)-4-methyl-2-phenylpiperazine
Description:
1-(3-Hydroxymethyl-2-pyridyl)-4-methyl-2-phenylpiperazine, identified by its CAS number 61337-89-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine core, which is a six-membered ring containing two nitrogen atoms, and is substituted with a hydroxymethyl group on a pyridine ring and a phenyl group. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The methyl and phenyl substituents contribute to its lipophilicity, potentially affecting its biological activity and pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest it could interact with biological targets, possibly influencing neurotransmitter systems or other pathways. However, specific applications, safety profiles, and regulatory status would require further investigation and are dependent on empirical studies.
Formula:C17H21N3O
InChI:InChI=1S/C17H21N3O/c1-19-10-11-20(17-15(13-21)8-5-9-18-17)16(12-19)14-6-3-2-4-7-14/h2-9,16,21H,10-13H2,1H3
InChI key:InChIKey=PYZPABZGIRHQTA-UHFFFAOYSA-N
SMILES:C(O)C1=C(N2C(CN(C)CC2)C3=CC=CC=C3)N=CC=C1
Synonyms:- 1-(3-Hydroxidmethylpyridine)-2-Phenyl-4-Methyl-Piperazine
- 1-(3-Hydroxymethyl pyridin-2-yl)-4-methyl-2- phenylpiperazine
- 1-(3-Hydroxymethyl-2-pyridyl)-4-methyl-2-phenylpiperazine
- 2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol
- 2-(4-Methyl-2-phenylpiperazin-1-yl)pyridine-3-methanol
- 3-Pyridinemethanol, 2-(4-Methyl-2-Phenyl-1-Piperazinyl)-
- [2-(4-Methyl-2-phenylpiperazin-1-yl)pyridin-3-yl]methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol
CAS:Formula:C17H21N3OPurity:95%Color and Shape:SolidMolecular weight:283.36812-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol
CAS:2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanolPurity:95%+Molecular weight:283.37g/molMirtazapine EP Impurity B
CAS:Formula:C17H21N3OColor and Shape:White To Off-White SolidMolecular weight:283.38Mirtazapine EP Impurity B
CAS:Controlled ProductFormula:C17H21N3OColor and Shape:NeatMolecular weight:283.372-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol
CAS:Controlled ProductApplications 2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol is an impurity found in Mirtazapine (M365000). Mirtazapine Impurity B.
Formula:C17H21N3OColor and Shape:White To Off-WhiteMolecular weight:283.372-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol
CAS:2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol is an impurity in hexane that is generated during the reaction of pyridine with acetonitrile. The impurity is removed by crystallizing it from methanol. 2-(4-Methyl-2-phenyl-1-piperazinyl)-3-pyridinemethanol has a high efficiency, and can be used to synthesize hexamethyldisiloxane. This product can be used as a metal catalyst for reactions involving alkali metals or metal halides. It can also be used as an alcohol solvent, but not hydrogenated.Formula:C17H21N3OPurity:Min. 95%Color and Shape:White to off white powderMolecular weight:283.37 g/mol







