CAS 61338-20-3

6-fluoro-4-oxo-1H-quinoline-3-carbonitrile

Description:

6-Fluoro-4-oxo-1H-quinoline-3-carbonitrile is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a fluorine atom at the 6-position and a carbonitrile group at the 3-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various chemical applications. The carbonitrile functional group enhances its reactivity, allowing for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit biological activity, which is of interest in drug discovery. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many quinoline derivatives, it may also possess antimicrobial or antitumor properties, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₀H₅FN₂O

InChI: InChI=1/C10H5FN2O/c11-7-1-2-9-8(3-7)10(14)6(4-12)5-13-9/h1-3,5H,(H,13,14)

SMILES: c1cc2c(cc1F)c(=O)c(C#N)c[nH]2

Synonyms:

• 6-Fluor-4-hydroxychinolin-3-carbonitril
• 6-Fluor-4-oxo-1,4-dihydrochinolin-3-carbonitril
• 6-Fluoro-4-Hydroxyquinoline-3-Carbonitrile
• 6-Fluoro-4-Oxo-1,4-Dihydroquinoline-3-Carbonitrile

6-Fluoro-4-hydroxyquinoline-3-carbonitrile

CAS: 61338-20-3

6-Fluoro-4-hydroxyquinoline-3-carbonitrile

Purity: ≥95%

Molecular weight: 188.16g/mol

Ref: 54-PC200609