CAS 61338-39-4

4-hydroxy-6,8-dimethoxy-quinoline-3-carbonitrile

Description:

4-Hydroxy-6,8-dimethoxy-quinoline-3-carbonitrile, with the CAS number 61338-39-4, is a chemical compound that belongs to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features multiple functional groups, including a hydroxyl group (-OH), two methoxy groups (-OCH3), and a cyano group (-CN), which contribute to its chemical reactivity and potential biological activity. The presence of the hydroxyl group may enhance its solubility in polar solvents, while the methoxy groups can influence its electronic properties and steric hindrance. The cyano group is known for its ability to participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, quinoline derivatives are often studied for their pharmacological properties, including antimicrobial and antitumor activities. Overall, 4-hydroxy-6,8-dimethoxy-quinoline-3-carbonitrile is a versatile compound with applications in research and potential therapeutic uses, although specific biological activities would require further investigation.

Formula: C₁₂H₁₀N₂O₃

InChI: InChI=1/C12H10N2O3/c1-16-8-3-9-11(10(4-8)17-2)14-6-7(5-13)12(9)15/h3-4,6H,1-2H3,(H,14,15)

SMILES: COc1cc2c(c(c1)OC)[nH]cc(C#N)c2=O

Synonyms:

• 4-Hydroxy-6,8-dimethoxychinolin-3-carbonitril
• 4-Hydroxy-6,8-Dimethoxyquinoline-3-Carbonitrile

4-Hydroxy-6,8-dimethoxyquinoline-3-carbonitrile

CAS: 61338-39-4

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₂O₃

Purity: Min. 95%

Molecular weight: 230.22 g/mol

Ref: 3D-LCA33839