CAS 6134-59-4
:1,3-Diethyl 2-(2-phenylhydrazinylidene)propanedioate
Description:
1,3-Diethyl 2-(2-phenylhydrazinylidene)propanedioate, with the CAS number 6134-59-4, is an organic compound characterized by its unique structure that includes a diethyl ester group and a phenylhydrazine moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the hydrazine group suggests reactivity that may be exploited in various chemical reactions, including condensation and coupling reactions. Additionally, the diethyl ester functionality contributes to its solubility properties, making it more amenable to various solvents. The compound may exhibit biological activity, which is of interest in pharmacological research. Its stability and reactivity can be influenced by factors such as pH and temperature, and it may undergo hydrolysis or other transformations under certain conditions. Overall, 1,3-Diethyl 2-(2-phenylhydrazinylidene)propanedioate is a versatile compound with significant implications in synthetic and medicinal chemistry.
Formula:C13H16N2O4
InChI:InChI=1S/C13H16N2O4/c1-3-18-12(16)11(13(17)19-4-2)15-14-10-8-6-5-7-9-10/h5-9,14H,3-4H2,1-2H3
InChI key:InChIKey=SHLSEDSSRWFXJI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(OCC)=O)=NNC1=CC=CC=C1
Synonyms:- Mesoxalic acid, diethyl ester, 2-(phenylhydrazone)
- Propanedioic acid, 2-(2-phenylhydrazinylidene)-, 1,3-diethyl ester
- Mesoxalic acid, diethyl ester, phenylhydrazone
- Propanedioic acid, (phenylhydrazono)-, diethyl ester
- Mesoxalic acid, phenylhydrazone, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
