CAS 61341-26-2

3-Methylthiophene-2-carbonyl chloride

Description:

3-Methylthiophene-2-carbonyl chloride is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a methyl group and a carbonyl chloride functional group. This compound is part of the thiophene family, which is known for its aromatic properties and sulfur-containing heterocycles. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic acyl substitution reactions, making it a useful intermediate in organic synthesis. Its reactivity is influenced by the electron-withdrawing nature of the carbonyl group, which can enhance electrophilicity. Additionally, the methyl group on the thiophene ring can affect the compound's physical properties, such as solubility and boiling point. 3-Methylthiophene-2-carbonyl chloride is typically handled with care due to its potential reactivity and the presence of chlorine, which can pose health hazards. Overall, this compound serves as a valuable building block in the synthesis of various pharmaceuticals and agrochemicals.

Formula: C₆H₅ClOS

InChI: InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3

SMILES: Cc1ccsc1C(=O)Cl

Synonyms:

• 2-Thiophenecarbonyl Chloride, 3-Methyl-
• 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE

3-Methyl-2-thenoyl Chloride

CAS: 61341-26-2

Formula: C₆H₅ClOS

Purity: >98.0%(GC)(T)

Color and Shape: Colorless to Brown clear liquid

Molecular weight: 160.62

Ref: 3B-M1711

3-Methylthiophene-2-carbonyl chloride

CAS: 61341-26-2

Formula: C₆H₅ClOS

Purity: 98%

Color and Shape: Liquid

Molecular weight: 160.6213

Ref: IN-DA003JS4

3-Methyl-thiophene-2-carbonyl chloride

CAS: 61341-26-2

Formula: C₆H₅ClOS

Purity: 98%

Color and Shape: Liquid

Molecular weight: 160.62

Ref: 10-F014753