CAS 61360-94-9

Flavosativaside

Description:

Flavosativaside, with the CAS number 61360-94-9, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. This compound is characterized by its polyphenolic structure, which typically includes multiple hydroxyl groups that contribute to its antioxidant properties. Flavosativaside is often studied for its potential effects on human health, including anti-inflammatory, antimicrobial, and anticancer activities. It is commonly found in various plant sources, particularly in fruits and vegetables, where it may play a role in plant defense mechanisms and contribute to the color and flavor of the produce. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Research into flavonoids like flavosativaside continues to explore their mechanisms of action and potential applications in nutraceuticals and pharmaceuticals, highlighting their importance in both dietary and therapeutic contexts.

Formula: C₂₇H₃₀O₁₅

InChI: InChI=1S/C27H30O15/c28-7-15-20(35)22(37)26(42-27-23(38)21(36)19(34)16(8-29)41-27)25(40-15)18-12(32)5-11(31)17-13(33)6-14(39-24(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-23,25-32,34-38H,7-8H2/t15-,16-,19-,20-,21+,22+,23-,25+,26-,27+/m1/s1

InChI key: InChIKey=FYTOTHFWELWOCG-OAFKVUNRSA-N

SMILES: OC=1C(=C2C(C(=O)C=C(O2)C3=CC=C(O)C=C3)=C(O)C1)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4

Synonyms:

• Vitexin 2′′-O-glucoside
• 2′′-O-Glucosylvitexin
• 4H-1-Benzopyran-4-one, 8-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-
• Flavosativaside
• 8-(2-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

Vitexin 2''-glucoside

CAS: 61360-94-9

Vitexin 2''-glucoside is a useful organic compound for research related to life sciences and the catalog number is T124550.

Formula: C₂₇H₃₀O₁₅

Color and Shape: Solid

Molecular weight: 594.522

Ref: TM-T124550

Vitexin 2''-glucoside

CAS: 61360-94-9

Natural glycoside

Formula: C₂₇H₃₀O₁₅

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 594.52

Ref: 5G-84193