CAS 613660-87-0

4-(Aminosulphonyl)benzeneboronic acid

Description:

4-(Aminosulphonyl)benzeneboronic acid, with the CAS number 613660-87-0, is an organic compound that features a boronic acid functional group attached to a benzene ring, which also carries an aminosulfonyl substituent. This compound is characterized by its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in medicinal chemistry and materials science. The presence of the aminosulfonyl group enhances its solubility in water and may contribute to its biological activity. Typically, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the synthesis of complex organic molecules. Additionally, this compound may exhibit properties such as moderate stability under standard conditions, and it can participate in acid-base reactions due to the acidic nature of the boronic acid group. Its unique structure allows for potential applications in drug development, particularly in targeting specific biological pathways or as a building block in the synthesis of more complex molecules.

Formula: C₆H₈BNO₄S

InChI: InChI=1/C6H8BNO4S/c8-13(11,12)6-3-1-5(2-4-6)7(9)10/h1-4,9-10H,(H2,8,11,12)

SMILES: c1cc(ccc1B(O)O)S(=O)(=O)N

Synonyms:

• 4-(Aminosulfonyl)phenylboronic acid
• (4-Sulfamoylphenyl)Boronic Acid

4-Boronobenzenesulfonamide

CAS: 613660-87-0

Formula: C₆H₈BNO₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 201.0080

Ref: IN-DA003726

4-Sulphamoylbenzeneboronic acid

CAS: 613660-87-0

4-Sulphamoylbenzeneboronic acid

Formula: C₆H₈BNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.01g/mol

Ref: 54-OR1186

(4-Aminosulfonylphenyl)boronic acid

CAS: 613660-87-0

Formula: C₆H₈BNO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 201

Ref: 10-F077993