CAS 61367-62-2
:4-Bromo-3,5-di-methoxybenzyl alcohol
Description:
4-Bromo-3,5-di-methoxybenzyl alcohol is an organic compound characterized by its aromatic structure, which includes a benzyl alcohol moiety substituted with bromine and methoxy groups. The presence of the bromine atom at the 4-position and two methoxy groups at the 3 and 5 positions on the benzene ring significantly influences its chemical properties, including its reactivity and solubility. This compound typically exhibits moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy groups contribute to its electron-donating characteristics, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Additionally, the bromine substituent can serve as a leaving group in various chemical transformations. 4-Bromo-3,5-di-methoxybenzyl alcohol may find applications in organic synthesis, medicinal chemistry, and as an intermediate in the production of more complex molecules. Its specific physical properties, such as melting point and boiling point, would need to be referenced from experimental data for precise applications.
Formula:C9H11BrO3
InChI:InChI=1/C9H11BrO3/c1-12-7-3-6(5-11)4-8(13-2)9(7)10/h3-4,11H,5H2,1-2H3
SMILES:COc1cc(cc(c1Br)OC)CO
Synonyms:- (4-Brom-3,5-dimethoxyphenyl)methanol
- (4-Bromo-3,5-dimethoxyphenyl)methanol
- Benzenemethanol, 4-Bromo-3,5-Dimethoxy-
- 4-Bromo-3,5-Dimethoxybenzyl Alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenemethanol, 4-bromo-3,5-dimethoxy-
CAS:Formula:C9H11BrO3Purity:98%Color and Shape:SolidMolecular weight:247.08584-Bromo-3,5-dimethoxybenzyl alcohol
CAS:4-Bromo-3,5-dimethoxybenzyl alcoholPurity:98%Color and Shape:SolidMolecular weight:247.09g/mol4-Bromo-3,5-dimethoxybenzyl alcohol
CAS:4-Bromo-3,5-dimethoxybenzyl alcohol is a bromoarene that can be used as a ligand in coupling reactions. It has been shown to be an efficient coupling partner for the synthesis of triphylla, featuring a skeleton of chelating 4-bromo-3,5-dimethoxybenzyl alcohol.Formula:C9H11BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:247.09 g/mol4-Bromo-3,5-dimethoxybenzylalcohol
CAS:Formula:C9H11BrO3Purity:95%Color and Shape:SolidMolecular weight:247.0884-Bromo-3,5-dimethoxybenzenemethanol-d6
CAS:Controlled ProductApplications Chemical building block used in the synthesis of more complex structures.
Formula:C9D6H5BrO3Color and Shape:NeatMolecular weight:253.123




