CAS 61370-75-0

2,2-dimethyl-3,4-dihydro-2H-chromene-6-carbaldehyde

Description:

2,2-Dimethyl-3,4-dihydro-2H-chromene-6-carbaldehyde is an organic compound characterized by its chromene structure, which features a fused benzene and pyran ring. This compound contains an aldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 2-position enhances its steric properties and may influence its solubility and boiling point. Typically, compounds like this can exhibit interesting biological activities, making them of interest in medicinal chemistry and natural product synthesis. The molecular structure allows for various functionalization possibilities, which can lead to derivatives with enhanced properties. Additionally, the compound's CAS number, 61370-75-0, serves as a unique identifier in chemical databases, facilitating research and information retrieval. Overall, 2,2-dimethyl-3,4-dihydro-2H-chromene-6-carbaldehyde is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₁₄O₂

InChI: InChI=1/C12H14O2/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-4,7-8H,5-6H2,1-2H3

SMILES: CC1(C)CCc2cc(ccc2O1)C=O

Synonyms:

• 2,2-Dimethylchromane-6-Carbaldehyde
• 2H-1-benzopyran-6-carboxaldehyde, 3,4-dihydro-2,2-dimethyl-
• 3,4-dihydro-2,2-dimethyl-2H-1-Benzopyran-6-carboxaldehyde

2,2-Dimethylchromane-6-carbaldehyde

CAS: 61370-75-0

Formula: C₁₂H₁₄O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.2384

Ref: IN-DA00EAIJ

2,2-Dimethylchromane-6-carboxaldehyde

CAS: 61370-75-0

2,2-Dimethylchromane-6-carboxaldehyde

Purity: 95%

Molecular weight: 190.24g/mol

Ref: 54-OR25425

2,2-Dimethylchroman-6-carbaldehyde

CAS: 61370-75-0

Formula: C₁₂H₁₄O₂

Purity: 96%

Molecular weight: 190.242

Ref: 10-F319625

2,2-Dimethylchromane-6-carbaldehyde

CAS: 61370-75-0

2,2-Dimethylchromane-6-carbaldehyde is a flavonoid compound that is structurally similar to abyssinone and resacetophenone. It has been shown to have anti-oxidant activity in the presence of hydrogen peroxide in vitro. 2,2-Dimethylchromane-6-carbaldehyde has also been shown to inhibit the growth of MCF7 cells by inducing apoptosis and cell cycle arrest at G0/G1 phase.

Formula: C₁₂H₁₄O₂

Purity: Min. 95%

Molecular weight: 190.24 g/mol

Ref: 3D-LCA37075