CAS 61379-68-8
:1-cyclobutylpiperazine dihydrochloride
Description:
1-Cyclobutylpiperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a cyclobutyl group enhances its structural diversity and may influence its biological activity. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, particularly in pharmaceutical formulations. This compound may exhibit psychoactive properties and has been studied for its potential effects on neurotransmitter systems, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with various biological targets, which can be explored for therapeutic purposes. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 1-cyclobutylpiperazine dihydrochloride represents a unique entity in the realm of organic compounds, with implications in research and development within the pharmaceutical industry.
Formula:C8H18Cl2N2
InChI:InChI=1/C8H16N2.2ClH/c1-2-8(3-1)10-6-4-9-5-7-10;;/h8-9H,1-7H2;2*1H
SMILES:C1CC(C1)N1CCNCC1.Cl.Cl
Synonyms:- Piperazine, 1-cyclobutyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

