
CAS 6138-94-9
:(3β,13α,14β,17α,20S,24Z)-Lanosta-7,24-diene-3,26-diol
Description:
The chemical substance known as (3β,13α,14β,17α,20S,24Z)-Lanosta-7,24-diene-3,26-diol, with the CAS number 6138-94-9, is a triterpenoid compound characterized by its complex steroidal structure. It features multiple chiral centers, which contribute to its stereochemistry and biological activity. This compound is primarily derived from natural sources, particularly fungi and certain plants, and is known for its potential pharmacological properties, including anti-inflammatory and antimicrobial activities. The presence of hydroxyl groups in its structure enhances its solubility in polar solvents and may influence its interaction with biological membranes. Additionally, the double bond in the lanostane framework contributes to its reactivity and stability. Research into this compound has indicated its significance in the biosynthesis of various steroids and its potential applications in medicine and biochemistry. Overall, (3β,13α,14β,17α,20S,24Z)-Lanosta-7,24-diene-3,26-diol exemplifies the intricate relationship between structure and function in organic compounds.
Formula:C30H50O2
InChI:InChI=1S/C30H50O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,21-23,25-26,31-32H,8,10,12-19H2,1-7H3/b20-9-/t21-,22-,23-,25-,26-,28+,29-,30+/m0/s1
InChI key:InChIKey=WCSYVWJCJYEXKL-KUOORNQFSA-N
SMILES:C[C@@]12C=3[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])(CC[C@@]1(C)[C@]([C@H](CC/C=C(\CO)/C)C)(CC2)[H])[H]
Synonyms:- Masticadienediol
- (3β,13α,14β,17α,20S,24Z)-Lanosta-7,24-diene-3,26-diol
- Lanosta-7,24-diene-3,26-diol, (3β,13α,14β,17α,20S,24Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Masticadienediol
CAS:Masticadienediol is a tetracyclic triterpene.Formula:C30H50O2Color and Shape:SolidMolecular weight:442.728
