CAS 61393-63-3

1-propanol-D8

Description:

1-Propanol-D8, also known as 1-deuteropropanol, is a deuterated form of 1-propanol, where the hydrogen atoms in the molecule are partially replaced by deuterium, a stable isotope of hydrogen. This compound has the molecular formula C3H8O, with the deuterated version having a formula of C3D8O. It is a colorless, flammable liquid with a characteristic alcohol odor, similar to that of its non-deuterated counterpart. 1-Propanol-D8 is primarily used in research and analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where the presence of deuterium helps to reduce background signals and improve the clarity of spectra. Its physical properties, such as boiling point and solubility, are similar to those of regular 1-propanol, but the presence of deuterium can influence reaction kinetics and mechanisms in chemical processes. As with other alcohols, it can act as a solvent and is miscible with water, making it useful in various chemical syntheses and formulations.

Formula: C₃D₈O

InChI: InChI=1/C3H8O/c1-2-3-4/h4H,2-3H2,1H3/i1D3,2D2,3D2,4D

SMILES: C(C(C(O[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• (2H7)propan-1-(2H)ol

n-Propyl Alcohol-d8

CAS: 61393-63-3

Formula: CD₃CD₂CD₂OD

Purity: 98 atom % D

Color and Shape: Colourless Liquid

Molecular weight: 68.10773

Ref: 3U-D2041

1-Propanol-d8

Controlled Product

CAS: 61393-63-3

Applications 1-Propanol-d8 is an intermediate used in the preparation of perdeuterated carboxylates, alcohols and alkyl bromides.
References Lipinski, K., et al.: Pol. J. Chem., 67, 667 (1993)

Formula: C₃D₈O

Color and Shape: Neat

Molecular weight: 68.14

Ref: TR-P760862