CAS 614-42-6
:2-(pentylamino)ethyl 4-aminobenzoate
Description:
2-(Pentylamino)ethyl 4-aminobenzoate, with the CAS number 614-42-6, is an organic compound characterized by its amine and ester functional groups. This substance features a pentylamino group attached to an ethyl chain, which is further linked to a 4-aminobenzoate moiety. The presence of both amine and ester functionalities suggests that it may exhibit properties such as solubility in organic solvents and potential reactivity in various chemical reactions, including nucleophilic substitutions. The compound is likely to be a solid or viscous liquid at room temperature, depending on its molecular weight and structure. Its applications may span across pharmaceuticals, where it could serve as an intermediate or active ingredient, and in materials science, potentially influencing polymer properties. Safety data should be consulted for handling, as compounds with amine groups can be irritants or toxic in certain concentrations. Overall, 2-(pentylamino)ethyl 4-aminobenzoate is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C14H22N2O2
InChI:InChI=1/C14H22N2O2/c1-2-3-4-9-16-10-11-18-14(17)12-5-7-13(15)8-6-12/h5-8,16H,2-4,9-11,15H2,1H3
SMILES:CCCCCNCCOC(=O)c1ccc(cc1)N
Synonyms:- 2188-67-2
- Ethanol, 2- (pentylamino)-, 4-aminobenzoate (ester)
- Ethanol, 2- (pentylamino)-, p-aminobenzoate (ester)
- Ethanol, 2-(pentylamino)-, 4-aminobenzoate (ester) (9CI)
- Ethanol, 2-(pentylamino)-, p-aminobenzoate (ester) (8CI)
- p-Aminobenzoic acid 2-(n-amylamino)ethyl ester
- p-Aminobenzoic acid 2-(n-pentylamino)ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Naepaine hydrochloride
CAS:Naepaine hydrochloride is a biochemical.Formula:C14H23ClN2O2Color and Shape:SolidMolecular weight:286.80


