CAS 614-57-3
:1,5-Diphenyl-2,4-pentadien-1-one
Description:
1,5-Diphenyl-2,4-pentadien-1-one, with the CAS number 614-57-3, is an organic compound characterized by its conjugated diene structure, which contributes to its unique chemical properties. This compound features two phenyl groups attached to a pentadienone backbone, making it a member of the chalcone family. It typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as a precursor in the production of various dyes and pharmaceuticals. The presence of the conjugated double bonds allows for significant electron delocalization, which can influence its reactivity and stability. Additionally, 1,5-diphenyl-2,4-pentadien-1-one exhibits interesting photophysical properties, making it a subject of study in fields such as photochemistry and materials science. Its solubility varies depending on the solvent, and it may undergo various chemical reactions, including oxidation and reduction, under appropriate conditions. Overall, this compound serves as a valuable building block in organic chemistry and materials development.
Formula:C17H14O
InChI:InChI=1S/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H
InChI key:InChIKey=QONKLJMPKWQQFG-UHFFFAOYSA-N
SMILES:C(C=CC=CC1=CC=CC=C1)(=O)C2=CC=CC=C2
Synonyms:- (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one
- 1,5-Diphenyl-1,3-pentadien-5-one
- 1,5-Diphenyl-2,4-pentadien-1-one
- 1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone
- 1,5-Diphenylpenta-2,4-Dien-1-One
- 2,4-Pentadien-1-one, 1,5-diphenyl-
- 2,4-Pentadienophenone, 5-phenyl-
- 5-Phenylpenta-2,4-Dienophenone
- Cinnamalacetophenone
- NSC 1991
- NSC 29119
- NSC 406761
- Sp 35
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cinnamylideneacetophenone, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C17H14OPurity:98+%Color and Shape:Crystals or powder or crystalline powder, YellowMolecular weight:234.30Cinnamylideneacetophenone
CAS:Formula:C17H14OPurity:98%Color and Shape:SolidMolecular weight:234.29251,5-Diphenyl-penta-2,4-dien-1-one
CAS:<p>1,5-Diphenyl-penta-2,4-dien-1-one is a natural compound that has been shown to have cytotoxic activity against human pathogens. It has been shown to inhibit the growth of gram-positive bacterial species by binding to dipole groups and preventing the formation of an enzyme complex required for cell division. 1,5-Diphenyl-penta-2,4-dien-1-one also inhibits the production of pyrazolines from benzoates in bacteria. When this molecule is metabolized by bacteria, it forms an aliphatic hydrocarbon with a chemical structure similar to that found in some carcinogens. 1,5 -Diphenyl penta 2,4 dien 1 one can be detected using NMR spectroscopy because it has a unique molecular structure. This compound also exhibits pharmacokinetic properties that are different from those of other molecules.</p>Formula:C17H14OPurity:Min. 95%Molecular weight:234.29 g/mol



