CAS 614-73-3
:1-ethoxy-2-iodobenzene
Description:
1-Ethoxy-2-iodobenzene, with the CAS number 614-73-3, is an organic compound that features both an ethoxy group and an iodine atom attached to a benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the ethoxy group (-OCH2CH3) enhances its solubility in organic solvents, while the iodine atom introduces a halogen that can participate in various chemical reactions, such as nucleophilic substitutions. 1-Ethoxy-2-iodobenzene is typically a colorless to pale yellow liquid and may have a sweet, aromatic odor. It is used in organic synthesis, particularly in the preparation of other chemical compounds through electrophilic aromatic substitution or as a reagent in coupling reactions. Additionally, the compound's properties, such as boiling point and density, are influenced by the substituents on the benzene ring, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H9IO
InChI:InChI=1/C8H9IO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3
InChI key:InChIKey=JUJREUXKABNEFA-UHFFFAOYSA-N
SMILES:O(CC)C1=C(I)C=CC=C1
Synonyms:- 2-Ethoxyiodobenzene
- 2-Iodophenetole
- Benzene, 1-ethoxy-2-iodo-
- Ethyl 2-iodophenyl ether
- NSC 9266
- Phenetole, o-iodo-,
- o-Ethoxyiodobenzene
- o-Iodophenetole
- 1-Ethoxy-2-iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Ethoxy-2-iodobenzene
CAS:1-Ethoxy-2-iodobenzene is a model complex that has been used to study the interactions between copper ions and chlorine atoms. The complexes are found in the chlorobenzene molecule, which is itself an organometallic compound. The covalent bonds in this complex are unsymmetrical, with a higher electron density on the carbon atom of the ethoxy group. 1-Ethoxy-2-iodobenzene has been shown to be carcinogenic, inducing mutations in ovary cells. This may be due to its interaction with DNA and interference with transcription.
Formula:C8H9IOPurity:Min. 95%Molecular weight:248.06 g/molRef: 3D-AAA61473
Discontinued product

