CAS 614-82-4
:2,4-Dihydroxyphenylacetic acid
Description:
2,4-Dihydroxyphenylacetic acid, with the CAS number 614-82-4, is an organic compound characterized by its aromatic structure featuring two hydroxyl groups and an acetic acid moiety. This compound is a derivative of phenylacetic acid, where the presence of hydroxyl groups at the 2 and 4 positions on the benzene ring enhances its solubility in water and influences its reactivity. It typically appears as a white to off-white crystalline solid and is known for its potential applications in pharmaceuticals and as a biochemical marker. The compound exhibits properties such as moderate acidity due to the carboxylic acid group, and it can participate in various chemical reactions, including esterification and oxidation. Additionally, 2,4-dihydroxyphenylacetic acid has been studied for its biological activities, including antioxidant properties and potential roles in metabolic pathways. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4,9-10H,3H2,(H,11,12)
InChI key:InChIKey=FSQDURCMBCGCIK-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(O)C=C(O)C=C1
Synonyms:- 2,4-Dihydroxybenzeneacetic acid
- 2-(2,4-Dihydroxyphenyl)acetic acid
- Acetic acid, (2,4-dihydroxyphenyl)-
- Benzeneacetic acid, 2,4-dihydroxy-
- Homo-beta-resorcylic acid
- 2,4-Dihydroxyphenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dihydroxyphenylacetic acid
CAS:2,4-Dihydroxyphenylacetic acid in spider toxin interacts with Fe-S center, key for glutamate binding.Formula:C8H8O4Purity:98%Color and Shape:SolidMolecular weight:168.1482,4-Dihydroxyphenylacetic acid
CAS:Formula:C8H8O4Purity:95%~99%Color and Shape:PowderMolecular weight:168.1482,4-Dihydroxyphenylacetic acid
CAS:2,4-Dihydroxyphenylacetic acid (2,4-DPA) is a norepinephrine (NE) precursor that acts as an anxiolytic drug. It is also a dopamine (DA) precursor and has been shown to inhibit the production of inflammatory cytokines by suppressing the production of tumor necrosis factor-α (TNF-α) in cell culture. 2,4-DPA has been shown to have antiinflammatory activity in animal models and in human cells. This drug enhances the effects of hydrochloric acid on amino acid analysis and may be used as an alternative to hydrochloric acid for preparative high performance liquid chromatography. 2,4-DPA is also capable of irreversible inhibition of bacterial dna gyrase and dna topoisomerase I enzymes. 2,4-DPA has been shown to inhibit the growth of infectious bacteria such as Mycobacterium tuberculosis and MycobacteriumFormula:C8H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:168.15 g/mol




