CymitQuimica logo

CAS 61414-16-2

:

4,4',4''-(1,3,5-triazine-2,4,6-triyl)tribenzoic acid

Description:
4,4',4''-(1,3,5-triazine-2,4,6-triyl)tribenzoic acid, with the CAS number 61414-16-2, is an organic compound characterized by its triazine core structure, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features three benzoic acid moieties attached to the triazine ring, contributing to its potential applications in materials science and organic synthesis. It is typically a solid at room temperature and may exhibit high thermal stability due to the presence of the triazine ring, which is known for its robust aromatic character. The presence of multiple carboxylic acid groups allows for hydrogen bonding and potential interactions with various substrates, making it useful in coordination chemistry and as a ligand in metal complexes. Additionally, its unique structure may impart interesting optical or electronic properties, making it a candidate for research in fields such as organic electronics or photonics. However, specific solubility, melting point, and reactivity details would require further investigation or empirical data.
Formula:C24H15N3O6
InChI:InChI=1/C24H15N3O6/c28-22(29)16-7-1-13(2-8-16)19-25-20(14-3-9-17(10-4-14)23(30)31)27-21(26-19)15-5-11-18(12-6-15)24(32)33/h1-12H,(H,28,29)(H,30,31)(H,32,33)
InChI key:MSFXUHUYNSYIDR-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1nc(c2ccc(cc2)C(=O)O)nc(c2ccc(cc2)C(=O)O)n1)C(=O)O
Synonyms:
  • 4,4',4''-(1,3,5-Triazine-2,4,6-Triyl)Tris-Benzoic Acid
Found 5 products.