CAS 61425-27-2
:Z-D-Alaninol
Description:
Z-D-Alaninol, with the CAS number 61425-27-2, is a chemical compound that belongs to the class of amino alcohols. It is characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a carbon chain, specifically derived from alanine, an essential amino acid. This compound typically exists as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. Z-D-Alaninol is often utilized in the synthesis of pharmaceuticals and as a chiral building block in organic chemistry due to its stereochemical properties. Its structure allows for potential interactions in biological systems, which can be leveraged in drug design and development. Additionally, the Z-configuration indicates a specific geometric arrangement around the double bond, which can influence the compound's reactivity and interaction with other molecules. Overall, Z-D-Alaninol is significant in both research and industrial applications, particularly in the fields of medicinal chemistry and biochemistry.
Formula:C11H15NO3
InChI:InChI=1/C11H15NO3/c1-9(7-13)12-11(14)15-8-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,12,14)/t9-/m1/s1
SMILES:C[C@H](CO)N=C(O)OCc1ccccc1
Synonyms:- N-Benzyloxycarbony
- L-D-Alaninoln-Cbz-D-Alaninol
- N-Z-D-Alaninol
- (R)-(+)-2-(Z-Amino)-1-Propanol
- Cbz-D-Alaninol
- benzyl [(1R)-2-hydroxy-1-methylethyl]carbamate
- N-Benzyloxycarbonyl-D-Alaninol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-Benzyloxycarbonyl-D-alaninol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H15NO3Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:209.25Carbamic acid, [(1R)-2-hydroxy-1-methylethyl]-, phenylmethyl ester
CAS:Formula:C11H15NO3Purity:97%Color and Shape:SolidMolecular weight:209.2417Z-D-Alaninol
CAS:Please enquire for more information about Z-D-Alaninol including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C11H15NO3Purity:Min. 95%Molecular weight:209.24 g/mol





