CAS 61444-62-0
:N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide
Description:
N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide, with the CAS number 61444-62-0, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with an amino group, a nitro group, and a trifluoromethyl group. The presence of multiple fluorine atoms in the tetrafluoropropanamide moiety contributes to its unique chemical properties, such as increased lipophilicity and potential stability against metabolic degradation. This compound may exhibit interesting biological activities due to its structural features, making it of interest in pharmaceutical research. Its solubility and reactivity can be influenced by the electron-withdrawing effects of the nitro and trifluoromethyl groups, which can affect its interactions in biological systems. Additionally, the compound's potential applications could extend to agrochemicals or materials science, where fluorinated compounds are often valued for their unique properties. However, specific safety and handling guidelines should be followed due to the presence of potentially hazardous functional groups.
Formula:C10H6F7N3O3
InChI:InChI=1/C10H6F7N3O3/c11-7(12)9(13,14)8(21)19-4-1-3(10(15,16)17)2-5(6(4)18)20(22)23/h1-2,7H,18H2,(H,19,21)
SMILES:c1c(cc(c(c1N=C(C(C(F)F)(F)F)O)N)N(=O)=O)C(F)(F)F
Synonyms:- 6'-Amino-a,a,a,2,2,3,3-heptafluoro-5'-nitropropion-m-toluidide
- N-[2-Amino-3-nitro-5-(trifluormethyl)phenyl]-2,2,3,3-tetrafluorpropanamid
- propanamide, N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoro-
- N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoro-prop anamide
- Compound-109168
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nifluridide
CAS:Controlled ProductApplications Nifluridide also known as L-27 reduces the growth and metastasis of MCF-7 tumor cells in xenografts models and thus may provide a new therapeutic approach for the treatment of breast and other types of cancer. A potential KGFR tyrosine kinase inhibitor. Nifluridide is also used in several pesticidal and insecticide compositions.
References Kesinger, J. W., et al.: Anticancer Res., 35, 47 (2015); Borth, P. W., et al.: J. Econ. Entomol., 79, 1632 (1986)Formula:C10H6F7N3O3Color and Shape:Off-WhiteMolecular weight:349.16

