CAS 61451-85-2

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6,8-trimethoxy-4H-chromen-4-one

Description:

The chemical substance known as 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6,8-trimethoxy-4H-chromen-4-one, with the CAS number 61451-85-2, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl (-OH) groups and methoxy (-OCH3) substituents, which contribute to its potential antioxidant properties. The presence of these functional groups enhances its ability to scavenge free radicals and may provide various health benefits, including anti-inflammatory and anticancer activities. The chromenone core structure is typical of flavonoids, which are known for their diverse biological activities. Additionally, the compound's solubility and stability can be influenced by its substituents, affecting its bioavailability and interaction with biological systems. Research into this compound may reveal further insights into its pharmacological potential and applications in nutraceuticals or pharmaceuticals. Overall, its unique chemical structure and properties make it a subject of interest in both medicinal chemistry and natural product research.

Formula: C₁₈H₁₆O₉

InChI: InChI=1/C18H16O9/c1-24-16-11(21)10-12(22)17(25-2)14(7-4-5-8(19)9(20)6-7)27-15(10)18(26-3)13(16)23/h4-6,19-21,23H,1-3H3

SMILES: COc1c(c2c(=O)c(c(c3ccc(c(c3)O)O)oc2c(c1O)OC)OC)O

Synonyms:

• 4H-1-benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6,8-trimethoxy-

3',4',5,7-tetrahydroxy 3,6,8-trimethoxyflavone

CAS: 61451-85-2

Oxygen-heterocyclic compound

Formula: C₁₈H₁₆O₉

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 376.32

Ref: 5G-82667

3′,4′,5,7-Tetrahydroxy-3,6,8-trimethoxyflavon

CAS: 61451-85-2

3',4',5,7-Tetrahydroxy-3,6,8-trimethoxyflavon is a versatile compound with various applications in the industrial and research fields. It possesses nucleophilic properties, making it suitable for reactions involving electron-rich substrates. This compound has been studied for its bioavailability and potential therapeutic effects, particularly in the development of pyrazoles and N-acyl derivatives.

Formula: C₁₈H₁₆O₉

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 376.3 g/mol

Ref: 3D-LCA45185