
CAS 61464-52-6
:(αZ)-α-Ethylidene-2,5-dihydro-3-methyl-2,5-dioxo-1H-pyrrole-1-acetic acid
Description:
(αZ)-α-Ethylidene-2,5-dihydro-3-methyl-2,5-dioxo-1H-pyrrole-1-acetic acid, with CAS number 61464-52-6, is a chemical compound that belongs to the class of pyrrole derivatives. This substance features a pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of the ethylidene group indicates a double bond between the carbon and the ethyl group, contributing to its reactivity. The compound also contains two carbonyl groups (dioxo), which are characteristic of diketones, enhancing its potential for various chemical reactions, including nucleophilic additions. The acetic acid moiety suggests that it possesses acidic properties, which may influence its solubility and reactivity in different environments. Overall, this compound may exhibit interesting biological activities and could be of interest in pharmaceutical or synthetic chemistry applications. Its specific characteristics, such as melting point, solubility, and reactivity, would require further investigation through experimental data.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c1-3-6(9(13)14)10-7(11)4-5(2)8(10)12/h3-4H,1-2H3,(H,13,14)/b6-3-
InChI key:InChIKey=NFDKQFGUQFNACT-UTCJRWHESA-N
SMILES:C(\C(O)=O)(=C/C)/N1C(=O)C(C)=CC1=O
Synonyms:- 1H-Pyrrole-1-acetic acid, α-ethylidene-2,5-dihydro-3-methyl-2,5-dioxo-, (Z)-
- 1H-Pyrrole-1-acetic acid, α-ethylidene-2,5-dihydro-3-methyl-2,5-dioxo-, (αZ)-
- (αZ)-α-Ethylidene-2,5-dihydro-3-methyl-2,5-dioxo-1H-pyrrole-1-acetic acid
- Pencolide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pencolide
CAS:Pencolide is a useful organic compound for research related to life sciences. The catalog number is T124546 and the CAS number is 61464-52-6.Formula:C9H9NO4Color and Shape:SolidMolecular weight:195.174
