CAS 61471-45-2
:3-(1H-pyrrol-1-yl)benzoic acid
Description:
3-(1H-pyrrol-1-yl)benzoic acid, with the CAS number 61471-45-2, is an organic compound characterized by the presence of a benzoic acid moiety substituted at the 3-position with a pyrrole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential acidity due to the carboxylic acid functional group. The pyrrole ring contributes to its unique electronic properties, which can influence its reactivity and interactions in various chemical environments. It may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the aromatic structure can enhance its stability and hydrophobic characteristics. This compound may be of interest in pharmaceutical and materials science research due to its potential biological activity and ability to participate in various chemical reactions, such as coupling and substitution reactions. Its specific applications and behavior can vary based on the context of use, including potential roles in drug development or as a building block in organic synthesis.
Formula:C11H8NO2
InChI:InChI=1/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14)/p-1
SMILES:c1ccn(c1)c1cccc(c1)C(=O)[O-]
Synonyms:- 3-(1H-pyrrol-1-yl)benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(1-Pyrrolyl)benzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H8NO2Purity:97%Color and Shape:Powder, CreamMolecular weight:186.193-(1H-Pyrrol-1-yl)benzoic acid
CAS:Formula:C11H9NO2Purity:98%Color and Shape:SolidMolecular weight:187.19473-(1H-Pyrrol-1-yl)benzoic acid
CAS:3-(1H-Pyrrol-1-yl)benzoic acidPurity:97%Color and Shape:Off-White PowderMolecular weight:187.19g/mol3-Pyrrol-1-yl-benzoic acid
CAS:Formula:C11H9NO2Purity:98%Color and Shape:Solid, Light brown powderMolecular weight:187.1983-(1H-Pyrrol-1-yl)benzoic acid
CAS:Versatile small molecule scaffold
Formula:C11H9NO2Purity:Min. 95%Molecular weight:187.2 g/mol




