CAS 614750-84-4

6-Iodo[1,2,4]triazolo[1,5-a]pyridine

Description:

6-Iodo[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by the presence of both a triazole and a pyridine ring, which contributes to its unique chemical properties. The compound features an iodine atom at the 6-position of the triazole ring, which can influence its reactivity and potential applications in medicinal chemistry. This structure allows for various interactions, including hydrogen bonding and π-π stacking, making it a candidate for biological activity. The presence of the triazole moiety often imparts stability and can enhance solubility in organic solvents. Additionally, compounds like this one are of interest in the development of pharmaceuticals, particularly in the fields of anti-inflammatory and antimicrobial agents. Its molecular weight, solubility characteristics, and specific reactivity profiles would depend on the surrounding functional groups and the overall molecular structure. As with many heterocycles, the compound's properties can be further explored through synthetic modifications or derivatization to enhance its biological efficacy or to tailor its physicochemical properties for specific applications.

Formula: C₆H₄IN₃

InChI: InChI=1/C6H4IN3/c7-5-1-2-6-8-4-9-10(6)3-5/h1-4H

SMILES: c1cc2ncnn2cc1I

Synonyms:

• [1,2,4]Triazolo[1,5-A]Pyridine, 6-Iodo-
• 6-Iodo-[1,2,4]Triazolo[1,5,A]Pyridine

6-iodo-[1,2,4]triazolo[1,5-a]pyridine

CAS: 614750-84-4

Formula: C₆H₄IN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.0205

Ref: IN-DA003N8W

6-Iodo-[1,2,4]triazolo[1,5-a]pyridine

CAS: 614750-84-4

6-Iodo-[1,2,4]triazolo[1,5-a]pyridine

Purity: 97%

Molecular weight: 245.02g/mol

Ref: 54-OR307049

6-Iodo-[1,2,4]triazolo[1,5-a]pyridine

CAS: 614750-84-4

Formula: C₆H₄IN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.023

Ref: 10-F216865