CAS 61479-41-2

3,3'-[benzene-1,3-diylbis(oxy)]dipropanoic acid

Description:

3,3'-[Benzene-1,3-diylbis(oxy)]dipropanoic acid, with the CAS number 61479-41-2, is an organic compound characterized by its structure, which features a central dipropanoic acid moiety linked to a benzene ring through ether linkages. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of carboxyl groups. The benzene ring contributes to its stability and hydrophobic characteristics, while the dipropanoic acid portion may impart some degree of hydrophilicity. This compound may be utilized in various applications, including as a building block in organic synthesis, in polymer chemistry, or as a potential intermediate in the production of more complex molecules. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₂H₁₄O₆

InChI: InChI=1/C12H14O6/c13-11(14)4-6-17-9-2-1-3-10(8-9)18-7-5-12(15)16/h1-3,8H,4-7H2,(H,13,14)(H,15,16)

SMILES: c1cc(cc(c1)OCCC(=O)O)OCCC(=O)O

Synonyms:

• Propanoic Acid, 3,3'-[1,3-Phenylenebis(Oxy)]Bis-

3,3'-[1,3-Phenylenebis(oxy)]dipropanoic acid

CAS: 61479-41-2

Please enquire for more information about 3,3'-[1,3-Phenylenebis(oxy)]dipropanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₄O₆

Purity: Min. 95%

Molecular weight: 254.24 g/mol

Ref: 3D-FP131541