CAS 6148-18-1

5-[(4-chlorophenoxy)methyl]-3-(4-methoxybenzyl)-1,2,4-oxadiazole

Description:

5-[(4-chlorophenoxy)methyl]-3-(4-methoxybenzyl)-1,2,4-oxadiazole, with the CAS number 6148-18-1, is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a chlorophenoxy group and a methoxybenzyl substituent, contributing to its potential biological activity and solubility properties. The presence of the chlorophenyl group may enhance lipophilicity, while the methoxy group can influence electronic properties and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. The oxadiazole moiety is known for its diverse applications in medicinal chemistry, often serving as a scaffold for drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in synthetic and medicinal chemistry research.

Formula: C₁₇H₁₅ClN₂O₃

InChI: InChI=1/C17H15ClN2O3/c1-21-14-6-2-12(3-7-14)10-16-19-17(23-20-16)11-22-15-8-4-13(18)5-9-15/h2-9H,10-11H2,1H3

SMILES: COc1ccc(cc1)Cc1nc(COc2ccc(cc2)Cl)on1

Synonyms:

• 1,2,4-Oxadiazole, 5-[(4-chlorophenoxy)methyl]-3-[(4-methoxyphenyl)methyl]-
• 5-(4-Chloro-phenoxymethyl)-3-(4-methoxy-benzyl)-[1,2,4]oxadiazole
• 5-[(4-Chlorophenoxy)methyl]-3-(4-methoxybenzyl)-1,2,4-oxadiazole

2-(Chloromethyl)quinazoline

CAS: 6148-18-1

Formula: C₉H₇ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.6183

Ref: IN-DA0032VC

2-(Chloromethyl)quinazoline

CAS: 6148-18-1

2-(Chloromethyl)quinazoline

Purity: 98%

Molecular weight: 178.622g/mol

Ref: 54-OR73872

2-(Chloromethyl)quinazoline

CAS: 6148-18-1

Formula: C₉H₇ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.62

Ref: 10-F540422