CymitQuimica logo

CAS 61487-25-0

:

(2-amino-3-chloro-phenyl)methanol

Description:
(2-amino-3-chloro-phenyl)methanol, with the CAS number 61487-25-0, is an organic compound characterized by the presence of an amino group (-NH2), a chloro substituent (-Cl), and a hydroxymethyl group (-CH2OH) attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity, while the chloro group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of these functional groups suggests that it may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C7H8ClNO
InChI:InChI=1/C7H8ClNO/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4,9H2
InChI key:XIHOYQMBAUMKCY-UHFFFAOYSA-N
SMILES:c1cc(CO)c(c(c1)Cl)N
Synonyms:
  • (2-Amino-3-chlorophenyl)methanol
  • Benzenemethanol, 2-Amino-3-Chloro-
Found 4 products.