CAS 61494-52-8
:pyrene-1-sulfonyl chloride
Description:
Pyrene-1-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a pyrene moiety, which is a polycyclic aromatic hydrocarbon. This compound typically appears as a solid, often in a crystalline form, and is known for its strong fluorescence properties due to the pyrene structure. Pyrene-1-sulfonyl chloride is reactive, particularly with nucleophiles, making it useful in various chemical reactions, including the synthesis of sulfonamides and other derivatives. It is also employed in labeling and tagging applications in biochemical research due to its fluorescent characteristics. The compound should be handled with care, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Proper safety precautions, including the use of personal protective equipment and working in a well-ventilated area or fume hood, are essential when working with this substance.
Formula:C16H9ClO2S
InChI:InChI=1/C16H9ClO2S/c17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H
SMILES:c1cc2ccc3ccc(c4ccc(c1)c2c34)S(=O)(=O)Cl
Synonyms:- 1-Pyrenesulfonyl chloride
- Pyrene-1-sulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyrene 1-sulfonyl chloride
CAS:<p>Pyrene 1-sulfonyl chloride is a fluorinated derivative of pyrene. It has been used for the detection of glycopeptides in human immunoglobulin and tissue culture samples. Pyrene 1-sulfonyl chloride binds to hydroxyl groups on proteins, which results in the formation of a fluorescent molecule. The reaction mechanism is similar to that of ethylene diamine, with the exception that pyrene 1-sulfonyl chloride reacts with proteins via a glycosidic bond rather than an amide bond. The radiation sensitivity of this compound is greater than that of ethylene diamine.</p>Formula:C16H9ClO2SPurity:Min. 85 Area-%Color and Shape:PowderMolecular weight:300.76 g/molPyrene 1-Sulfonyl Chloride
CAS:Controlled ProductFormula:C16H9ClO2SColor and Shape:NeatMolecular weight:300.76


