CAS 61494-55-1

(2-Chloropyridin-3-yl)acetic acid

Description:

(2-Chloropyridin-3-yl)acetic acid is an organic compound characterized by its pyridine ring structure, which features a chlorine substituent at the 2-position and an acetic acid functional group attached at the 3-position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. Its molecular structure contributes to its potential reactivity, particularly in nucleophilic substitution reactions due to the electron-withdrawing effect of the chlorine atom. The compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Additionally, it can serve as an intermediate in the synthesis of various chemical entities. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose environmental and health risks. Proper storage conditions and handling protocols are essential to ensure safety and stability.

Formula: C₇H₆ClNO₂

InChI: InChI=1/C7H6ClNO2/c8-7-5(4-6(10)11)2-1-3-9-7/h1-3H,4H2,(H,10,11)

SMILES: c1cc(CC(=O)O)c(Cl)nc1

Synonyms:

• 2-(2-Chloropyridin-3-Yl)Acetic Acid
• 2-Chloro-3-Pyridineacetic Acid
• 3-Pyridineacetic Acid, 2-Chloro-
• (2-Chloro-pyridin-3-yl)-acetic acid

2-Chloro-3-pyridineacetic acid

CAS: 61494-55-1

Formula: C₇H₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA0038LM

(2-Chloropyridin-3-yl)acetic acid

CAS: 61494-55-1

(2-Chloropyridin-3-yl)acetic acid

Purity: 97%

Molecular weight: 171.58g/mol

Ref: 54-OR40337

2-Chloro-pyridine-3-yl-acetic acid

CAS: 61494-55-1

Formula: C₇H₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F049277

(2-Chloropyridin-3-yl)acetic acid

CAS: 61494-55-1

Versatile small molecule scaffold

Formula: C₇H₆ClNO₂

Purity: Min. 95%

Molecular weight: 171.6 g/mol

Ref: 3D-LCA49455