CAS 615-29-2

4-Methyl-3-hexanol

Description:

4-Methyl-3-hexanol is an organic compound classified as a secondary alcohol. Its molecular formula is C7H16O, indicating it contains seven carbon atoms, sixteen hydrogen atoms, and one oxygen atom. This compound features a hydroxyl (-OH) functional group attached to a hexane backbone, specifically at the third carbon, with a methyl group substituent at the fourth carbon. 4-Methyl-3-hexanol is typically a colorless liquid with a characteristic alcohol odor. It is soluble in water due to the presence of the hydroxyl group, which allows for hydrogen bonding, while also being soluble in organic solvents. The compound is used in various applications, including as a solvent and in the synthesis of other chemicals. Its physical properties include a moderate boiling point and a relatively low vapor pressure, making it less volatile compared to smaller alcohols. Safety data indicates that, like many alcohols, it should be handled with care due to potential irritant effects and flammability.

Formula: C₇H₁₆O

InChI: InChI=1/C7H16O/c1-4-6(3)7(8)5-2/h6-8H,4-5H2,1-3H3/t6-,7-/m0/s1

InChI key: InChIKey=NZPGYIBESMMUFU-UHFFFAOYSA-N

SMILES: C(C(CC)O)(CC)C

Synonyms:

• 4-Methyl-3-hexanol
• 4-Methylhexan-3-ol
• 3-Pentanol, 2-ethyl-
• 3-Hexanol, 4-methyl-
• 2-Ethyl-3-pentanol