CAS 615-59-8: 2,5-Dibromotoluene
Description:2,5-Dibromotoluene, with the CAS number 615-59-8, is an aromatic organic compound characterized by the presence of two bromine atoms and a methyl group attached to a toluene backbone. It features a benzene ring substituted at the 2 and 5 positions with bromine atoms, which significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. 2,5-Dibromotoluene is utilized in various chemical syntheses, particularly in the production of pharmaceuticals, agrochemicals, and other brominated compounds. The presence of bromine enhances its reactivity, making it a useful intermediate in organic synthesis. However, like many brominated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its physical and chemical properties, such as boiling point, melting point, and density, can vary based on specific conditions and purity levels.
Formula:C7H6Br2
InChI:InChI=1S/C7H6Br2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3
InChI key:InChIKey=QKEZTJYRBHOKHH-UHFFFAOYSA-N
SMILES:BrC1=CC=C(Br)C(=C1)C
- Synonyms:
- 1,4-Dibromo-2-Methylbenzene
- 1,4-Dibromotoluene
- 3,6-Dibromotoluene
- Benzene, 1,4-dibromo-2-methyl-
- Nsc 6222
- Toluene, 2,5-dibromo-
- 2,5-Dibromotoluene
