CymitQuimica logo

CAS 6150-88-5

:

Magnesium,[ethanedioato(2-)-kO1,kO2]-, hydrate (1:2)

Description:
The chemical substance known as Magnesium, ethanedioato(2-)-kO1,kO2]-, hydrate (1:2), with the CAS number 6150-88-5, is a coordination compound featuring magnesium ions coordinated to ethanedioate (oxalate) ligands. This compound typically exhibits a crystalline structure and is characterized by its ability to form stable complexes due to the chelating nature of the oxalate ligands, which can bind to the magnesium ion through multiple oxygen atoms. The presence of water molecules in its hydrated form contributes to its stability and solubility in aqueous solutions. Magnesium, being an essential element, plays a crucial role in various biological processes, and its coordination with organic ligands like oxalate can influence its bioavailability and reactivity. The compound may exhibit specific optical and thermal properties, which can be relevant in various applications, including catalysis and materials science. Overall, this substance is of interest in both inorganic chemistry and biochemistry due to its unique coordination chemistry and potential applications.
Formula:C2MgO4H2O
InChI:InChI=1S/C2H2O4.Mg.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+2;;/p-2
InChI key:PJYWQDOJMBTCCO-UHFFFAOYSA-L
SMILES:C(=O)(C(=O)[O-])[O-].O.O.[Mg+2]
Synonyms:
  • Magnesium,[ethanedioato(2-)-O,O']-, dihydrate
  • Magnesium, [ethanedioato(2-)-kO1,kO2]-, dihydrate
  • Oxalic acid, magnesium salt(1:1), dihydrate
  • Magnesium oxalate (1:1) dihydrate
  • Magnesium oxalatedihydrate
Found 3 products.