CAS 6152-33-6
:[1,1′-Biphenyl]-2-ol, sodium salt, hydrate (1:1:4)
Description:
[1,1′-Biphenyl]-2-ol, sodium salt, hydrate (1:1:4), with the CAS number 6152-33-6, is a chemical compound characterized by its biphenyl structure with a hydroxyl group (-OH) at the 2-position of one of the phenyl rings. As a sodium salt, it typically exists as a white to off-white solid, which may be hygroscopic, indicating its ability to absorb moisture from the environment. This compound is often used in various chemical applications, including as a reagent in organic synthesis and as an intermediate in the production of other chemicals. Its solubility in water is influenced by the presence of the sodium ion, which enhances its ionic character. The hydrate form suggests that it contains water molecules in its crystalline structure, which can affect its stability and reactivity. Overall, [1,1′-Biphenyl]-2-ol, sodium salt, hydrate is notable for its role in chemical synthesis and potential applications in pharmaceuticals and materials science.
Formula:C12H10O·4H2O·Na
InChI:InChI=1S/C12H10O.Na.4H2O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;;/h1-9,13H;;4*1H2
InChI key:InChIKey=TXMQFDBXZGJHFX-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC=CC=C2)C=CC=C1.[Na].O
Synonyms:- 2-Biphenylol, Sodium Salt, Tetrahydrate
- [1,1'-Biphenyl]-2-Ol, Sodium Salt, Hydrate (1:1:4)
- o-Phenylphenol, sodium salt, tetrahydrate
- [1,1′-Biphenyl]-2-ol, sodium salt, tetrahydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Phenylphenol Sodium Salt Tetrahydrate
CAS:Formula:C12H9NaO·4H2OPurity:>98.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:264.252-Hydroxybiphenyl sodium salt tetrahydrate
CAS:2-Hydroxybiphenyl sodium salt tetrahydrate is an inorganic, colorimetric mediator that is used for the determination of symbiotic N 2 fixation. It is a salt of 2-hydroxybiphenyl and sodium hydroxide. The color change from yellow to violet is indicative of the presence of nitrogenase activity. This mediator can be used to measure the efficiency of immobilized N 2 -fixing bacteria on various surfaces or to determine the uptake of nutrients by bacteria.
Formula:C12H17NaO5Purity:Min. 95%Molecular weight:264.25 g/mol


