CAS 61520-53-4

2-[(2-ethyl-6-methylphenyl)amino]propan-1-ol

Description:

2-[(2-ethyl-6-methylphenyl)amino]propan-1-ol, with the CAS number 61520-53-4, is an organic compound characterized by its amine and alcohol functional groups. This substance features a propanol backbone, which contributes to its solubility in polar solvents, and an aromatic ring substituted with an ethyl and a methyl group, enhancing its hydrophobic characteristics. The presence of the amino group indicates potential basicity and reactivity, allowing for interactions with acids and other electrophiles. This compound may exhibit biological activity, making it of interest in pharmaceutical applications. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties such as boiling point and melting point. Additionally, the steric hindrance introduced by the ethyl and methyl substituents may affect its reactivity and interaction with biological targets. Overall, 2-[(2-ethyl-6-methylphenyl)amino]propan-1-ol is a compound with diverse potential applications, particularly in medicinal chemistry and related fields.

Formula: C₁₂H₁₉NO

InChI: InChI=1/C12H19NO/c1-4-11-7-5-6-9(2)12(11)13-10(3)8-14/h5-7,10,13-14H,4,8H2,1-3H3

SMILES: CCc1cccc(C)c1NC(C)CO

Metolachlor-des(chloroacetyl)-O-desmethyl

CAS: 61520-53-4

Formula: C₁₂H₁₉NO

Color and Shape: Neat

Molecular weight: 193.29

Ref: 04-C15171070

Deschloroacetylmetolachlor Propanol

Controlled Product

CAS: 61520-53-4

Applications Deschloroacetylmetolachlor Propanol is a pesticide that is detected in drinking water.
References Hladik, Michelle L. et al., Water Research. 42, 4905-4914(2008);

Formula: C₁₂H₁₉NO

Color and Shape: Neat

Molecular weight: 193.29

Ref: TR-D353925

2-[(2-Ethyl-6-methylphenyl)amino]propan-1-ol

CAS: 61520-53-4

Versatile small molecule scaffold

Formula: C₁₂H₁₉NO

Purity: Min. 95%

Molecular weight: 193.28 g/mol

Ref: 3D-LCA52053