CAS 6153-05-5
:(2Z)-3-Methyl-2-penten-4-yn-1-ol
Description:
(2Z)-3-Methyl-2-penten-4-yn-1-ol, with the CAS number 6153-05-5, is an organic compound characterized by its unique structure, which includes a conjugated system of double and triple bonds. This compound features a hydroxyl (-OH) functional group, making it an alcohol, and it has a branched alkene structure due to the presence of a methyl group. The "Z" configuration indicates that the highest priority substituents on the double bond are on the same side, which can influence its reactivity and physical properties. Typically, compounds like this may exhibit moderate volatility and can be soluble in organic solvents. They may also participate in various chemical reactions, such as nucleophilic additions or eliminations, due to the presence of both the alcohol and the unsaturated carbon framework. Additionally, the compound's structure suggests potential applications in organic synthesis or as intermediates in the production of more complex molecules. However, specific properties such as boiling point, melting point, and density would require empirical measurement or literature reference for precise values.
Formula:C6H8O
InChI:InChI=1S/C6H8O/c1-3-6(2)4-5-7/h1,4,7H,5H2,2H3/b6-4-
InChI key:InChIKey=ZSJHASYJQIRSLE-XQRVVYSFSA-N
SMILES:C(=C\CO)(\C#C)/C
Synonyms:- (2Z)-3-Methyl-2-penten-4-yn-1-ol
- (2Z)-3-methylpent-2-en-4-yn-1-ol
- 2-Penten-4-yn-1-ol, 3-methyl-, (2Z)-
- 2-Penten-4-yn-1-ol, 3-methyl-, (Z)-
- Z-3-Methyl-2-penten-4-yn-1-ol
- cis-3-Methyl-2-penten-4-yn-1-ol
- cis-3-Methyl-2-pentene-4-yn-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(Z)-3-Methylpent-2-en-4-yn-1-ol
CAS:Controlled ProductApplications (Z)-3-Methylpent-2-en-4-yn-1-ol is used as a reagent in organic synthesis of many compounds including that of prolycopene which is a tangerine-colored tetra-Z-isomer of lycopene that is found in fruits of the tangerine tomato. Z)-3-Methylpent-2-en-4-yn-1-ol is also used in the synthesis of Leucosceptroids A and B which have potent antifungal properties.
References Pattenden, G., et al.: Tetrahedron Lett., 28, 5751 (1987); Guo, S., et al.: Angew. Chem. Int. Edit., 54, 1298 (2015);Formula:C6H8OColor and Shape:NeatMolecular weight:96.13(Z)-3-Methylpent-2-en-4-yn-1-ol
CAS:Formula:C6H8OPurity:95%Color and Shape:Liquid, OilMolecular weight:96.129

