CAS 6153-44-2
:Methyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate
Description:
Methyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate, with the CAS number 6153-44-2, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing nitrogen atoms. This substance features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of two carbonyl (C=O) groups contributes to its dioxo functionality, while the carboxylate group indicates that it can exist in a deprotonated form, enhancing its reactivity. Methyl ester functionality suggests that it can participate in various chemical reactions, including hydrolysis and transesterification. The compound is likely to exhibit polar characteristics due to the presence of electronegative atoms, which can influence its solubility in polar solvents. Its potential applications may span across pharmaceuticals and agrochemicals, given the structural motifs common in biologically active compounds. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C6H6N2O4
InChI:InChI=1S/C6H6N2O4/c1-12-5(10)3-2-4(9)8-6(11)7-3/h2H,1H3,(H2,7,8,9,11)
InChI key:InChIKey=UUTDWTOZAWFKFW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=O)NC(=O)N1
Synonyms:- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, methyl ester
- 6-(Methoxycarbonyl)uracil
- 6-Carbomethoxyuracil
- Methyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate
- Methyl 2,6-Dioxo-1,2,3,6-Tetrahydropyrimidine-4-Carboxylate
- Methyl orotate
- NSC 42009
- Orotic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate
CAS:Methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylatePurity:98%Molecular weight:170.12g/molMethyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate
CAS:Methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate is an intermediate in the synthesis of a compound that has potential as a drug target for metabolic disorders. It is formed from the reaction of benzimidazole compounds and uridine. Methyl 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate is metabolized to picolinic acid and orotic acid by acid complex formation or to epidermal growth factor (EGF) and growth factor (GF). The methyl group can be removed by demethylation with alkenes.Formula:C6H6N2O4Purity:Min. 95%Molecular weight:170.12 g/mol



