CAS 6154-71-8
:(2S,3R,5S)-2-methoxy-6-methyl-tetrahydropyran-3,5-diol
Description:
The chemical substance known as (2S,3R,5S)-2-methoxy-6-methyl-tetrahydropyran-3,5-diol, with the CAS number 6154-71-8, is a cyclic organic compound characterized by its tetrahydropyran ring structure. This compound features multiple stereocenters, which contribute to its specific three-dimensional configuration and influence its chemical reactivity and biological activity. The presence of hydroxyl (-OH) groups at the 3 and 5 positions of the tetrahydropyran ring indicates that it is a diol, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy (-OCH3) group at the 2 position and the methyl (-CH3) group at the 6 position further modify its properties, potentially affecting its interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its stereochemistry and functional groups suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis.
Formula:C7H14O4
InChI:InChI=1/C7H14O4/c1-4-5(8)3-6(9)7(10-2)11-4/h4-9H,3H2,1-2H3/t4?,5-,6+,7-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3,6-dideoxy-a-D-arabino-hexopyranoside
CAS:Methyl 3,6-dideoxy-a-D-arabino-hexopyranoside is a fluorinated sugar analog. It is a monosaccharide that has been synthesized and modified to include an amine group for the purpose of glycosylation. Methyl 3,6-dideoxy-a-D-arabino-hexopyranoside has CAS number 6154-71-8 and can be found in the Polysaccharides category. The compound is soluble in water, ethanol, methanol, acetone, ethyl acetate and chloroform. Methyl 3,6-dideoxy-a-D-arabino-hexopyranoside has a molecular weight of 392.5 grams per mole and a density of 1.3 grams per cubic centimeter. Methyl 3,6 -dideoxy -a -D -arabino -hexopyranoside isFormula:C7H14O4Purity:Min. 95%Molecular weight:162.19 g/mol

