CAS 61541-77-3

5-methyl-4-phenylpyrimidin-2-amine

Description:

5-Methyl-4-phenylpyrimidin-2-amine, with the CAS number 61541-77-3, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a methyl group at the 5-position and a phenyl group at the 4-position of the pyrimidine ring, along with an amino group at the 2-position. These substituents contribute to its chemical properties, including its potential as a building block in pharmaceutical synthesis and its role in various biochemical applications. The presence of the amino group suggests that it may participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced or altered properties. Overall, 5-methyl-4-phenylpyrimidin-2-amine is a versatile compound with potential applications in research and industry.

Formula: C₁₁H₁₁N₃

InChI: InChI=1/C11H11N3/c1-8-7-13-11(12)14-10(8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,12,13,14)

SMILES: Cc1c[nH]c(=N)nc1c1ccccc1

2-Amino-5-methyl-4-phenylpyrimidine

CAS: 61541-77-3

2-Amino-5-methyl-4-phenylpyrimidine

Purity: ≥95%

Molecular weight: 185.23g/mol

Ref: 54-OR97939

5-METHYL-4-PHENYLPYRIMIDIN-2-AMINE

CAS: 61541-77-3

Formula: C₁₁H₁₁N₃

Purity: 95.0%

Molecular weight: 185.23

Ref: 10-F537740

5-Methyl-4-phenylpyrimidin-2-amine

CAS: 61541-77-3

Versatile small molecule scaffold

Formula: C₁₁H₁₁N₃

Purity: Min. 95%

Molecular weight: 185.22 g/mol

Ref: 3D-LCA54177