CAS 6155-35-7
:L-rhamnose monohydrate
Description:
L-rhamnose monohydrate is a naturally occurring sugar and a deoxyhexose, specifically a methyl pentose, that plays a significant role in various biological processes. It is characterized by its white crystalline appearance and is soluble in water, making it useful in various applications, including food and pharmaceutical industries. The chemical formula for L-rhamnose monohydrate is C6H12O6·H2O, indicating that it contains six carbon atoms, twelve hydrogen atoms, and six oxygen atoms, along with one water molecule. This compound is known for its sweet taste, although it is less sweet than glucose. L-rhamnose is often found in the glycosidic linkages of polysaccharides and is important in the structure of certain plant cell walls. Additionally, it has been studied for its potential health benefits, including its role in immune response and as a prebiotic. Its CAS number, 6155-35-7, is used for identification in chemical databases and regulatory contexts.
Formula:C6H14O6
InChI:InChI=1/C6H12O5.H2O/c1-2-3(7)4(8)5(9)6(10)11-2;/h2-10H,1H3;1H2/t2-,3-,4+,5+,6?;/m0./s1
Synonyms:- a-L-Rhamnose Monohydrate
- 5,5-dimethyl-2-[(phenylcarbamoyl)amino]-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxamide
- 6-deoxy-L-mannopyranose hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
a-L-Mannopyranose, 6-deoxy-, monohydrate
CAS:Formula:C6H14O6Purity:98%Color and Shape:SolidMolecular weight:182.1718α-L-Rhamnose Monohydrate
CAS:Controlled ProductFormula:C6H12O5·H2OColor and Shape:NeatMolecular weight:182.17α-L-Rhamnose monohydrate
CAS:α-L-Rhamnose monohydrate (6-deoxy-L-mannose monohydrate) is a component of bacterial polysaccharides where it plays an important role in pathogenicity.Formula:C6H14O6Purity:99.84%Color and Shape:White Cream Crystalline PowderMolecular weight:182.17L-Rhamnose Monohydrate
CAS:Applications Composition of plum leaf polysaccharides.
References Andrews, P., et al.: J. Chem. Soc., 4476 (1958),Formula:C6H12O5·H2OColor and Shape:NeatMolecular weight:182.17α-L-Rhamnose monohydrate
CAS:a-L-Rhamnose monohydrate is a white crystalline solid that is soluble in water. It has a molecular weight of 296.03, a melting point of 117 °C, and a density of 1.5 g/cm3. The solubility of this compound in water is dependent on the concentration and temperature; it exhibits the highest solubility at 25 °C and concentrations between 0.1% and 2%. The solubility decreases with increasing pH, but increases with increasing ionic strength or proton concentration.Formula:C6H12O5•H2OPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:182.17 g/molL-Rhamnose monohydrate
CAS:Formula:C6H14O6Purity:98%Color and Shape:Powder or Crystalline PowderMolecular weight:182.172







