
CAS 615534-45-7
:1-Ethyl-3-iodo-2(1H)-pyridinone
Description:
1-Ethyl-3-iodo-2(1H)-pyridinone, identified by its CAS number 615534-45-7, is a heterocyclic organic compound featuring a pyridinone structure. This compound is characterized by the presence of an ethyl group and an iodine atom at specific positions on the pyridine ring, which contributes to its unique chemical properties. It typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, making it useful in various chemical reactions and applications. The iodine substituent can enhance the compound's reactivity, particularly in nucleophilic substitution reactions, while the pyridinone moiety may impart biological activity, potentially making it of interest in medicinal chemistry. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the presence of the carbonyl group, influencing its physical and chemical behavior. Overall, 1-Ethyl-3-iodo-2(1H)-pyridinone is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C7H8INO
InChI:InChI=1S/C7H8INO/c1-2-9-5-3-4-6(8)7(9)10/h3-5H,2H2,1H3
InChI key:InChIKey=OUXOAZLZTHOECQ-UHFFFAOYSA-N
SMILES:C(C)N1C(=O)C(I)=CC=C1
Synonyms:- 1-Ethyl-3-iodo-1,2-dihydropyridin-2-one
- 1-Ethyl-3-iodo-2(1H)-pyridinone
- 2(1H)-Pyridinone, 1-ethyl-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.