CAS 615534-73-1

1-(3-iodobenzyl)-1H-1,2,4-triazole

Description:

1-(3-Iodobenzyl)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a benzyl group substituted with an iodine atom at the meta position, contributing to its unique chemical properties. The presence of the iodine atom can enhance the compound's reactivity and influence its biological activity, making it of interest in medicinal chemistry and material science. The triazole moiety is known for its ability to form hydrogen bonds and participate in coordination chemistry, which can be beneficial in various applications, including as a potential antifungal or antibacterial agent. Additionally, the compound may exhibit interesting electronic properties due to the presence of the aromatic ring and halogen substituent. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, making it a subject of study in both organic synthesis and pharmacological research.

Formula: C₉H₈IN₃

InChI: InChI=1/C9H8IN3/c10-9-3-1-2-8(4-9)5-13-7-11-6-12-13/h1-4,6-7H,5H2

SMILES: c1cc(cc(c1)I)Cn1cncn1

1-(3-Iodobenzyl)-1H-1,2,4-triazole

CAS: 615534-73-1

1-(3-Iodobenzyl)-1H-1,2,4-triazole

Purity: 95%

Molecular weight: 285.08g/mol

Ref: 54-OR9246