CAS 61556-45-4

3'-O-methylguanosine 5'-(tetrahydrogen triphosphate)

Description:

3'-O-methylguanosine 5'-(tetrahydrogen triphosphate), commonly referred to as 3'-O-methyl-GTP, is a modified nucleotide that plays a significant role in various biochemical processes, particularly in RNA synthesis and signaling pathways. This compound features a guanosine base with a methyl group attached to the 3' hydroxyl position, which can influence its interaction with enzymes and other nucleotides. The presence of the triphosphate group is crucial for its function, as it provides the necessary energy for polymerization reactions and serves as a substrate for RNA polymerases. The modification at the 3' position can enhance the stability of RNA molecules and affect their translation efficiency. Additionally, 3'-O-methyl-GTP is often used in research to study RNA processing and modification, as well as in the development of therapeutic agents targeting RNA-related pathways. Its unique structural characteristics contribute to its specific biological activities and potential applications in molecular biology and biochemistry.

Formula: C₁₁H₁₈N₅O₁₄P₃

InChI: InChI=1/C11H18N5O14P3/c1-26-7-4(2-27-32(22,23)30-33(24,25)29-31(19,20)21)28-10(6(7)17)16-3-13-5-8(16)14-11(12)15-9(5)18/h3-4,6-7,10,17H,2H2,1H3,(H,22,23)(H,24,25)(H2,19,20,21)(H3,12,14,15,18)/t4-,6-,7-,10?/m1/s1

SMILES: CO[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC([C@@H]1O)n1cnc2c1[nH]c(=N)nc2O

Synonyms:

• 3'-O-methylguanosine triphosphate
• Guanosine 5'-(tetrahydrogen triphosphate), 3'-O-methyl-

3'-O-Methylguanosine 5'-triphosphate lithium

CAS: 61556-45-4

3'-O-Methylguanosine 5'-triphosphate lithium is a nucleotide that has been synthesized and characterized. It is a biochemical regulatory molecule that is involved in the synthesis of DNA, RNA, and proteins. 3'-O-Methylguanosine 5'-triphosphate lithium binds to the guanine nucleotide binding protein G, which acts as an allosteric activator of the enzyme ribonucleotide reductase. The reconstituted enzyme system containing 3'-O-methylguanosine 5'-triphosphate lithium has demonstrated a high level of fidelity in the replication of dna templates.

Formula: C₁₁H₁₈N₅O₁₄P₃•Li₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 564.97 g/mol

Ref: 3D-NM46052