CAS 61566-33-4
:methyl [4-(2-methylpropyl)phenyl]acetate
Description:
Methyl [4-(2-methylpropyl)phenyl]acetate, with the CAS number 61566-33-4, is an organic compound characterized by its ester functional group. It features a methyl acetate moiety linked to a phenyl ring that is further substituted with a branched alkyl group, specifically 2-methylpropyl. This structure contributes to its unique physical and chemical properties, including a relatively low boiling point and moderate solubility in organic solvents. The compound is likely to exhibit a pleasant, fruity aroma, making it potentially useful in flavoring and fragrance applications. Its molecular structure suggests it may participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Additionally, due to the presence of the aromatic ring, it may also exhibit some degree of stability against oxidation. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use in industrial or laboratory settings.
Formula:C13H18O2
InChI:InChI=1/C13H18O2/c1-10(2)8-11-4-6-12(7-5-11)9-13(14)15-3/h4-7,10H,8-9H2,1-3H3
SMILES:CC(C)Cc1ccc(cc1)CC(=O)OC
Synonyms:- Benzeneacetic Acid, 4-(2-Methylpropyl)-, Methyl Ester
- Methyl (4-isobutylphenyl)acetate
- methyl 2-(4-isobutylphenyl)acetate
- p-isobutylphenylacetic acid methyl ester
- Ibufenac Impurity 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ibufenac Methyl Ester
CAS:Controlled ProductFormula:C13H18O2Color and Shape:NeatMolecular weight:206.28


