CAS 61566-58-3
:2,4-diaminobenzoic acid dihydrochloride
Description:
2,4-Diaminobenzoic acid dihydrochloride is a chemical compound characterized by its structure, which includes two amino groups (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring. This compound is a derivative of benzoic acid and is typically encountered as a dihydrochloride salt, enhancing its solubility in water. It appears as a white to off-white crystalline powder and is known for its role in various biochemical applications, particularly in the synthesis of dyes and pharmaceuticals. The presence of amino groups makes it a potential candidate for reactions involving amine chemistry, such as coupling reactions. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. Safety data indicates that, like many amines, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage conditions are essential to maintain its stability and efficacy.
Formula:C7H10Cl2N2O2
InChI:InChI=1/C7H8N2O2.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3H,8-9H2,(H,10,11);2*1H
SMILES:c1cc(c(cc1N)N)C(=O)O.Cl.Cl
Synonyms:- Benzoic Acid, 2,4-Diamino-, Hydrochloride (1:2)
- 2,4-Diaminobenzoic Acid Dihydrochloride
- 2,4-Diaminobenzoic acid diHCl
- 2,4-DiaminobenzoicAcidDihydrochloride>
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,4-Diaminobenzoic acid diHCl
CAS:Formula:C7H10Cl2N2O2Purity:98.0%Color and Shape:SolidMolecular weight:225.07252,4-Diaminobenzoic acid dihydrochloride
CAS:2,4-Diaminobenzoic acid dihydrochloride is a versatile building block for complex compounds. This compound can be used as a research chemical and is also a reagent and speciality chemical. 2,4-Diaminobenzoic acid dihydrochloride has been used in the synthesis of many useful compounds, including pharmaceuticals and agrochemicals. It is also an intermediate in the synthesis of some pharmaceuticals and agrochemicals. 2,4-Diaminobenzoic acid dihydrochloride can be used as a scaffold to produce new molecules that are potentially useful as drugs or other chemicals.Formula:C7H8N2O2•(HCL)2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:225.07 g/mol


