CAS 61576-99-6

2,3,5,6-tetrachloro-1,1':4',1''-terphenyl

Description:

2,3,5,6-tetrachloro-1,1':4',1''-terphenyl, with the CAS number 61576-99-6, is a synthetic organic compound characterized by its complex structure comprising three phenyl rings interconnected by carbon-carbon bonds, with four chlorine atoms substituted at specific positions on the outer rings. This compound is typically a solid at room temperature and exhibits a high degree of stability due to the presence of chlorine substituents, which enhance its resistance to degradation. It is often used in research and industrial applications, particularly in the field of materials science and as a potential additive in various formulations. The chlorinated nature of this compound may impart unique electronic and thermal properties, making it of interest for applications in electronics and photonics. However, due to its chlorine content, it may also raise environmental and health concerns, necessitating careful handling and disposal. Overall, 2,3,5,6-tetrachloro-1,1':4',1''-terphenyl is a notable compound within the realm of chlorinated aromatic compounds.

Formula: C₁₈H₁₀Cl₄

InChI: InChI=1/C18H10Cl4/c19-14-10-15(20)18(22)16(17(14)21)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H

SMILES: c1ccc(cc1)c1ccc(cc1)c1c(c(cc(c1Cl)Cl)Cl)Cl