CAS 61578-30-1
:4-nitroso(3,3,5,5-~2~H_4_)morpholine
Description:
4-Nitroso(3,3,5,5-2H4)morpholine, with the CAS number 61578-30-1, is a chemical compound that belongs to the class of nitroso compounds. It features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom and five carbon atoms. The presence of the nitroso group (-NO) introduces unique reactivity and properties, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. This compound is characterized by its ability to participate in electrophilic reactions due to the electron-withdrawing nature of the nitroso group. Additionally, the deuterated form indicated by "2H4" suggests that it contains four deuterium atoms, which can influence its isotopic properties and stability. The compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be affected by factors such as temperature and light exposure. As with many nitroso compounds, it is essential to handle it with care due to potential toxicity and reactivity.
Formula:C4H4D4N2O2
InChI:InChI=1/C4H8N2O2/c7-5-6-1-3-8-4-2-6/h1-4H2/i1D2,2D2
SMILES:C1(COCC(N1N=O)([2H])[2H])([2H])[2H]
Synonyms:- 3,3,5,5-Tetradeutero-N-nitrosomorpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Nitrosomorpholine-d4
CAS:Controlled Product<p>Applications Labelled N-Nitrosomorpholine (N529985). It is a frequently used genotoxic model carcinogen. Toxicogenomic analysis of N-Nitrosomorpholine induced changes in rat liver.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Cunningham, M., et al.: Toxicol. Sci., 70, 157 (2002), Ashida, S., et al.: Cancer Res., 64, 5963 (2004), Donninger, H., et al.: Oncogene, 23, 8065 (2004),<br></p>Formula:C42H4H4N2O2Color and Shape:YellowMolecular weight:120.14
