CAS 616-24-0: 3-Pentanamine
Description:3-Pentanamine, also known as 3-amino-pentane, is an organic compound characterized by its amine functional group (-NH2) attached to a five-carbon alkane chain. Its molecular formula is C5H13N, indicating the presence of five carbon atoms, thirteen hydrogen atoms, and one nitrogen atom. This compound is a colorless to pale yellow liquid with a characteristic amine odor. It is soluble in water and organic solvents, making it versatile for various applications. 3-Pentanamine is primarily used in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. It exhibits basic properties typical of amines, allowing it to participate in various chemical reactions, such as alkylation and acylation. Additionally, it can form salts with acids, which can enhance its solubility and stability. Safety considerations include its potential to cause irritation to the skin, eyes, and respiratory system, necessitating proper handling and storage protocols. Overall, 3-pentanamine is a valuable compound in chemical synthesis and industrial applications.
Formula:C5H13N
InChI:InChI=1S/C5H13N/c1-3-5(6)4-2/h5H,3-4,6H2,1-2H3
InChI key:InChIKey=PQPFFKCJENSZKL-UHFFFAOYSA-N
SMILES:NC(CC)CC
- Synonyms:
- 1-Ethylpropylamine
- 3-Aminopentane
- 3-Pentanamine
- NSC 165575
- Pentan-3-Amine
- Pentan-3-Aminium
- Propylamine, 1-ethyl-
- 3-Pentylamine
