CAS 616-52-4
:pinacolyl methylphosphonate
Description:
Pinacolyl methylphosphonate, with the CAS number 616-52-4, is an organophosphorus compound characterized by its structure, which includes a methylphosphonate group and a pinacolyl moiety. This compound is typically a colorless to pale yellow liquid with a slightly sweet odor. It is known for its stability under normal conditions but can hydrolyze in the presence of strong acids or bases. Pinacolyl methylphosphonate is soluble in organic solvents such as ethanol and ether, but it has limited solubility in water. It is primarily recognized for its applications in the synthesis of various chemical intermediates and as a potential precursor in the production of chemical agents. Due to its phosphorus content, it can exhibit toxicity and poses environmental concerns, necessitating careful handling and storage. Additionally, it is important to note that this compound may have regulatory implications due to its potential use in chemical warfare, which has led to increased scrutiny and control measures in various jurisdictions.
Formula:C13H29O3P
InChI:InChI=1/C13H29O3P/c1-10(12(3,4)5)15-17(9,14)16-11(2)13(6,7)8/h10-11H,1-9H3
SMILES:CC(C(C)(C)C)OP(=O)(C)OC(C)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pinacolyl Methylphosphonate
CAS:Controlled ProductFormula:C7H17O3PColor and Shape:NeatMolecular weight:180.1818
