CAS 616-87-5
:(3-methylbutyl)propanedioic acid
Description:
(3-Methylbutyl)propanedioic acid, also known by its CAS number 616-87-5, is an organic compound characterized by its dicarboxylic acid structure. It features two carboxylic acid functional groups (-COOH) attached to a three-carbon backbone, with a methyl group branching off the third carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in polar solvents like water and alcohols, owing to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The presence of the branched alkyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. (3-Methylbutyl)propanedioic acid can participate in various chemical reactions typical of dicarboxylic acids, such as esterification and decarboxylation. It may find applications in organic synthesis, particularly in the production of esters and other derivatives used in pharmaceuticals, agrochemicals, and polymer chemistry. As with many organic acids, it should be handled with care due to its potential corrosive nature.
Formula:C8H14O4
InChI:InChI=1/C8H14O4/c1-5(2)3-4-6(7(9)10)8(11)12/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
