CAS 6160-12-9
:sparteine sulfate
Description:
Sparteine sulfate, with the CAS number 6160-12-9, is a chemical compound derived from sparteine, an alkaloid obtained from the plant Lupinus. It typically appears as a white to off-white crystalline powder and is known for its solubility in water and organic solvents. Sparteine sulfate is primarily recognized for its pharmacological properties, particularly its role as a chiral auxiliary in asymmetric synthesis and its potential use in medicinal chemistry. The compound exhibits a range of biological activities, including effects on the cardiovascular system and potential applications in treating certain medical conditions. Its structure features a sulfate group, which contributes to its solubility and reactivity. As with many chemical substances, handling sparteine sulfate requires caution due to its biological activity, and appropriate safety measures should be taken to mitigate any potential risks. Overall, sparteine sulfate is an important compound in both natural product chemistry and pharmaceutical research.
Formula:C15H38N2O9S
InChI:InChI=1/C15H26N2.H2O4S.5H2O/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;1-5(2,3)4;;;;;/h12-15H,1-11H2;(H2,1,2,3,4);5*1H2/t12-,13+,14-,15+;;;;;;
Synonyms:- (7Alpha)-Sparteine Sulfate Hydrate (1:1:5)
- (-)-Sparteine Sulfate Pentahydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(-)-Sparteine sulfate pentahydrate
CAS:<p>(-)-Sparteine sulfate pentahydrate ((-)-Sparteine Sulfate) is a class 1a antiarrhythmic agent and a sodium channel blocker.</p>Formula:C15H38N2O9SPurity:95.66% - ≥98%Color and Shape:White Fine Crystalline PowderMolecular weight:422.547,14-Methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine,dodecahydro-, (7S,7aR,14S,14aS)-, sulfate (1:1), pentahydrate
CAS:Formula:C15H38N2O9SPurity:98%Color and Shape:SolidMolecular weight:422.5352(-)-Sparteine sulfate pentahydrate
CAS:(-)-Sparteine sulfate pentahydratePurity:≥95%Molecular weight:422.54g/mol


